CAS 10345-87-6
:3-Phenyl-2-cyclohexen-1-one
Description:
3-Phenyl-2-cyclohexen-1-one, with the CAS number 10345-87-6, is an organic compound characterized by its unique bicyclic structure, which features a cyclohexene ring fused with a phenyl group. This compound typically exhibits a yellow to brown color and is known for its aromatic properties due to the presence of the phenyl group. It is a ketone, which means it contains a carbonyl group (C=O) that contributes to its reactivity and potential applications in organic synthesis. The compound is often studied for its role in various chemical reactions, including Michael additions and as a precursor in the synthesis of more complex organic molecules. Its physical properties, such as solubility and melting point, can vary depending on the specific conditions and purity of the sample. Additionally, 3-Phenyl-2-cyclohexen-1-one may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Overall, its structural features and reactivity make it a valuable compound in both academic research and industrial applications.
Formula:C12H12O
InChI:InChI=1S/C12H12O/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2
InChI key:InChIKey=DIELDZAPFMXAHA-UHFFFAOYSA-N
SMILES:O=C1C=C(CCC1)C2=CC=CC=C2
Synonyms:- 1-Phenyl-1-cyclohexen-3-one
- 1-Phenylcyclohexen-3-one
- 2-Cyclohexen-1-one, 3-phenyl-
- 3-Phenyl-2-cyclohexen-1-one
- 3-Phenyl-2-cyclohexene-1-one
- 3-Phenyl-2-cyclohexenone
- Nsc 63067
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Phenyl-2-cyclohexen-1-one
CAS:3-Phenyl-2-cyclohexen-1-oneFormula:C12H12OPurity:97%Molecular weight:172.223-Phenylcyclohex-2-en-1-one
CAS:Formula:C12H12OPurity:97%Color and Shape:SolidMolecular weight:172.22313-Phenyl-2-cyclohexen-1-one
CAS:Controlled ProductFormula:C12H12OColor and Shape:NeatMolecular weight:172.225,6-Dihydro[1,1'-biphenyl]-3(4H)-one
CAS:5,6-Dihydro[1,1'-biphenyl]-3(4H)-one is a chemical compound that has been synthesized by irradiation of cyclobutane with borohydride reduction. This reaction produces the desired product in high yield and in a regioselective manner. The chalcones are crosslinked and the styrene is reduced to give divinylbenzene. 5,6-Dihydro[1,1'-biphenyl]-3(4H)-one has been shown to have high potential as an intermediate for organic synthesis. It has been used in the synthesis of a variety of functionalized chalcones and alcohols. This product can be used as a solvent for reactions involving solvents such as chloroform or ether.Formula:C12H12OPurity:Min. 95%Molecular weight:172.22 g/mol




