CAS 1035555-63-5

tak733

Description:

Tak733, identified by its CAS number 1035555-63-5, is a chemical compound that functions primarily as a selective inhibitor of certain kinases, particularly those involved in cellular signaling pathways. It is often studied in the context of cancer research due to its potential to interfere with tumor growth and proliferation by targeting specific molecular pathways. The compound exhibits a relatively high affinity for its targets, which makes it a subject of interest in the development of targeted therapies. In terms of its physical properties, Tak733 is typically characterized by its molecular structure, which includes specific functional groups that contribute to its biological activity. Its solubility, stability, and reactivity can vary depending on the formulation and conditions under which it is studied. As with many chemical substances, safety and handling precautions are essential, particularly in laboratory settings, to mitigate any potential hazards associated with its use. Overall, Tak733 represents a significant area of research in medicinal chemistry and pharmacology.

Formula: C17H15F2IN4O4

InChI: InChI=1S/C17H15F2IN4O4/c1-23-15-12(16(27)24(7-21-15)5-9(26)6-25)14(13(19)17(23)28)22-11-3-2-8(20)4-10(11)18/h2-4,7,9,22,25-26H,5-6H2,1H3/t9-/m1/s1

InChI key: RCLQNICOARASSR-SECBINFHSA-N

SMILES: CN1C2=C(C(=C(C1=O)F)NC3=C(C=C(C=C3)I)F)C(=O)N(C=N2)C[C@H](CO)O

TAK-733

CAS: 1035555-63-5

TAK-733

Formula: C₁₇H₁₅F₂IN₄O₄

Purity: ≥98%

Molecular weight: 504.23

Ref: 54-BUP07561

TAK-733

CAS: 1035555-63-5

TAK-733 is an orally bioavailable small-molecule inhibitor of MEK1 and MEK2 (MEK1/2) with potential antineoplastic activity.

Formula: C₁₇H₁₅F₂IN₄O₄

Purity: 98.31% - 99.2%

Color and Shape: White Solid

Molecular weight: 504.2267

Ref: TM-T6692

TAK-733

CAS: 1035555-63-5

(R)-3-(2,3-Dihydroxypropyl)-6-fluoro-5-((2-fluoro-4-iodophenyl)amino)-8-methylpyrido[2,3-d]pyrimidine-4,7(3H,8H)-dione

Formula: C₁₇H₁₅F₂IN₄O₄

Purity: 98%

Molecular weight: 504.23

Ref: IN-DG316819

TAK 733

CAS: 1035555-63-5

Inhibitor of MEK1 and MEK2 kinases

Formula: C₁₇H₁₅F₂IN₄O₄

Purity: Min. 95%

Molecular weight: 504.23 g/mol

Ref: 3D-FT103481

TAK-733

CAS: 1035555-63-5

Formula: C₁₇H₁₅F₂IN₄O₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 504.2267

Ref: IN-DA008TJT