CAS 1036-72-2
:5,7-Dimethoxyflavanone
Description:
5,7-Dimethoxyflavanone is a flavonoid compound characterized by its flavanone structure, which consists of a 15-carbon skeleton typically found in many plant-derived substances. This compound features two methoxy groups (-OCH3) attached to the flavanone backbone at the 5 and 7 positions, which can influence its solubility, stability, and biological activity. It is often recognized for its potential antioxidant properties and has been studied for various pharmacological effects, including anti-inflammatory and anticancer activities. The presence of methoxy groups can enhance its lipophilicity, allowing for better membrane permeability. 5,7-Dimethoxyflavanone is commonly found in certain plants and may contribute to the color and flavor of fruits and flowers. Its CAS number, 1036-72-2, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. As with many flavonoids, it may also exhibit a range of biological activities, making it a subject of interest in natural product research and medicinal chemistry.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-9,14H,10H2,1-2H3
InChI key:InChIKey=IAFBOKYTDSDNHV-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(CC2=O)C3=CC=CC=C3)=CC(OC)=C1
Synonyms:- 2,3-Dihydro-5,7-dimethoxy-2-phenyl-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dimethoxy-2-phenyl-
- 5,7-Dimethoxy-2-phenylchroman-4-one
- 5,7-dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one
- Flavanone, 5,7-dimethoxy-
- Pinocembrin dimethyl ether
- 5,7-Dimethoxyflavanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5,7-Dimethoxyflavanone
CAS:5,7-Dimethoxyflavanone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C17H16O4Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:284.325,7-Dimethoxyflavanone
CAS:5,7-Dimethoxyflavanone exhibits µM-level inhibition against MCF-7 and NCI-H187 cells (IC50=36 µM).Formula:C17H16O4Purity:99.96%Color and Shape:White SolidMolecular weight:284.315,7-Dimethoxyflavanone
CAS:5,7-Dimethoxyflavanone is a flavonoid derivative, which is a type of polyphenolic compound predominantly found in plants. This compound is often isolated from various botanical sources, where it contributes to the plant's adaptive defense mechanisms against environmental stressors. The mode of action of 5,7-Dimethoxyflavanone involves interaction with cellular signaling pathways, potentially influencing antioxidant, anti-inflammatory, and enzyme inhibition activities through modulation of molecular targets.Formula:C17H16O4Purity:Min. 95%Molecular weight:284.31 g/mol





