CAS 103604-53-1

3' 5'-DIETHOXYACETOPHENONE 99

Description:

3',5'-Diethoxyacetophenone, with the CAS number 103604-53-1, is an organic compound characterized by its structure, which includes an acetophenone core substituted with two ethoxy groups at the 3' and 5' positions of the aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its applications in organic synthesis, particularly as a photoinitiator in polymerization processes and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the ethoxy groups enhances its solubility in organic solvents, making it versatile in various chemical reactions. Additionally, 3',5'-diethoxyacetophenone may exhibit UV-absorbing properties, which can be beneficial in specific applications such as coatings and inks. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential health risks associated with exposure.

Formula: C₁₂H₁₆O₃

InChI: InChI=1/C12H16O3/c1-4-14-11-6-10(9(3)13)7-12(8-11)15-5-2/h6-8H,4-5H2,1-3H3

SMILES: CCOc1cc(cc(c1)OCC)C(=O)C

Synonyms:

• 1-(3,5-Diethoxyphenyl)Ethanone

1-(3,5-Diethoxyphenyl)Ethanone

CAS: 103604-53-1

1-(3,5-Diethoxyphenyl)Ethanone

Formula: C₁₂H₁₆O₃

Purity: 98%

Molecular weight: 208.25

Ref: 54-OR1008925

1-(3,5-Diethoxyphenyl)ethanone

CAS: 103604-53-1

1-(3,5-Diethoxyphenyl)ethanone

Formula: C₁₂H₁₆O₃

Purity: 98%

Molecular weight: 208.25

Ref: IN-DG261986

3' 5'-DIETHOXYACETOPHENONE 99

CAS: 103604-53-1

Formula: C₁₂H₁₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.2536

Ref: IN-DA009NZR

1-(3,5-Diethoxyphenyl)ethan-1-one

CAS: 103604-53-1

Purity: 98%

Molecular weight: 208.2570038

Ref: 10-F769377

3,5-Diethoxyacetophenone

CAS: 103604-53-1

3,5-Diethoxyacetophenone is a high quality chemical that can be used as a reagent or a useful intermediate. It is also a fine chemical that can be used to produce speciality chemicals with various properties, such as research chemicals and versatile building blocks. 3,5-Diethoxyacetophenone has the CAS number 103604-53-1 and can react with other chemicals to form reaction components.

Formula: C₁₂H₁₆O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 208.25 g/mol

Ref: 3D-FD71094