CymitQuimica logo

CAS 103633-30-3

:

2-BENZYLOXYBENZYLBROMIDE

Description:
2-Benzyloxybenzylbromide, identified by its CAS number 103633-30-3, is an organic compound characterized by the presence of both a bromine atom and a benzyloxy functional group. This compound features a biphenyl structure, where one of the phenyl rings is substituted with a benzyloxy group, enhancing its reactivity and solubility in organic solvents. The bromine atom serves as a good leaving group, making it useful in various synthetic applications, particularly in nucleophilic substitution reactions. The presence of the benzyloxy group can also influence the compound's electronic properties, potentially affecting its reactivity and stability. Typically, compounds like 2-Benzyloxybenzylbromide are utilized in organic synthesis, including the preparation of more complex molecules in medicinal chemistry and materials science. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the substance. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C14H13BrO
InChI:InChI=1S/C14H13BrO/c15-10-13-8-4-5-9-14(13)16-11-12-6-2-1-3-7-12/h1-9H,10-11H2
InChI key:YMLAVJJQEPGJAP-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=CC=CC=C2CBr
Found 3 products.