CymitQuimica logo

CAS 103637-50-9

:

2-(4-Benzoyl-3-hydroxyphenoxy)-1-[(4-benzoyl-3-hydroxyphenoxy)methyl]ethyl 2-propenoate

Description:
2-(4-Benzoyl-3-hydroxyphenoxy)-1-[(4-benzoyl-3-hydroxyphenoxy)methyl]ethyl 2-propenoate, with CAS number 103637-50-9, is a synthetic organic compound characterized by its complex structure, which includes multiple aromatic rings and functional groups. This compound features a propenoate moiety, indicating it has an unsaturated ester functional group, which can participate in various chemical reactions, including polymerization. The presence of benzoyl and hydroxyphenyl groups suggests potential applications in photochemistry and as a UV absorber, making it relevant in fields such as materials science and pharmaceuticals. Its molecular structure may confer specific solubility properties, influencing its behavior in different solvents. Additionally, the compound's potential biological activity could be explored in medicinal chemistry, particularly in the development of therapeutic agents. Overall, its unique structural features and functional groups make it a compound of interest for further research and application in various chemical and industrial processes.
Formula:C32H26O8
InChI:InChI=1S/C32H26O8/c1-2-30(35)40-25(19-38-23-13-15-26(28(33)17-23)31(36)21-9-5-3-6-10-21)20-39-24-14-16-27(29(34)18-24)32(37)22-11-7-4-8-12-22/h2-18,25,33-34H,1,19-20H2
InChI key:InChIKey=KQVIDCCKLYDABT-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(O)C=C(OCC(COC2=CC(O)=C(C(=O)C3=CC=CC=C3)C=C2)OC(C=C)=O)C=C1)C4=CC=CC=C4
Synonyms:
  • 2-(4-Benzoyl-3-hydroxyphenoxy)-1-[(4-benzoyl-3-hydroxyphenoxy)methyl]ethyl 2-propenoate
  • 2-Propenoic acid, 2-(4-benzoyl-3-hydroxyphenoxy)-1-[(4-benzoyl-3-hydroxyphenoxy)methyl]ethyl ester
  • 1,3-Bis(4-benzoyl-3-hydroxyphenoxy)-2-propyl acrylate
Found 1 products.