CymitQuimica logo

CAS 1036381-91-5

:

tert-butyl 2-oxo-1,2,7,8-tetrahydro-1,6-naphthyridine-6(5H)-carboxylate

Description:
Tert-butyl 2-oxo-1,2,7,8-tetrahydro-1,6-naphthyridine-6(5H)-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a naphthyridine moiety. This compound features a tert-butyl ester functional group, contributing to its lipophilicity and potential solubility in organic solvents. The presence of the 2-oxo group indicates that it may exhibit keto-enol tautomerism, which can influence its reactivity and stability. The tetrahydro configuration suggests that the compound is saturated, which may affect its physical properties, such as boiling and melting points. Additionally, the carboxylate group can participate in various chemical reactions, including esterification and nucleophilic attacks. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. As with many organic compounds, its safety and handling require adherence to standard laboratory protocols to mitigate any potential hazards.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c1-13(2,3)18-12(17)15-7-6-10-9(8-15)4-5-11(16)14-10/h4-5H,6-8H2,1-3H3,(H,14,16)
InChI key:SYYLNESTCFDFBW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=O)N2
Found 4 products.