CymitQuimica logo

CAS 1036389-09-9

:

1H-Isoindol-1-one, 6-aMino-4-fluoro-2,3-dihydro-

Description:
1H-Isoindol-1-one, 6-amino-4-fluoro-2,3-dihydro- is a chemical compound characterized by its isoindole structure, which features a fused bicyclic system comprising a benzene ring and a five-membered nitrogen-containing ring. This compound contains an amino group and a fluorine atom, which can influence its reactivity and biological activity. The presence of the amino group suggests potential for hydrogen bonding and interaction with biological targets, while the fluorine atom may enhance lipophilicity and metabolic stability. The dihydro form indicates that the compound has two hydrogen atoms added to the double bonds of the isoindole structure, which can affect its electronic properties and sterics. This compound may be of interest in medicinal chemistry due to its structural features that could lead to pharmacological activity. Its specific applications and interactions would depend on further studies, including its synthesis, stability, and biological assays. As with many organic compounds, safety and handling precautions should be observed when working with this substance.
Formula:C8H7FN2O
InChI:InChI=1S/C8H7FN2O/c9-7-2-4(10)1-5-6(7)3-11-8(5)12/h1-2H,3,10H2,(H,11,12)
InChI key:HIRGFZNFRSWZPP-UHFFFAOYSA-N
SMILES:C1C2=C(C=C(C=C2F)N)C(=O)N1
Found 2 products.