CymitQuimica logo

CAS 1036389-83-9

:

2-Bromo-4-fluoro-5-nitrobenzoic acid

Description:
2-Bromo-4-fluoro-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a bromine atom, a fluorine atom, and a nitro group. The molecular structure features a bromine atom at the second position, a fluorine atom at the fourth position, and a nitro group at the fifth position of the benzene ring, contributing to its unique reactivity and properties. This compound is typically a solid at room temperature and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of the nitro group imparts significant electron-withdrawing characteristics, influencing its acidity and reactivity in various chemical reactions. It may be used in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that can participate in further chemical transformations. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H3BrFNO4
InChI:InChI=1S/C7H3BrFNO4/c8-4-2-5(9)6(10(13)14)1-3(4)7(11)12/h1-2H,(H,11,12)
InChI key:InChIKey=APETYHSLTIVOQX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N(=O)=O)=C(F)C=C1Br
Synonyms:
  • 2-Bromo-4-fluoro-5-nitrobenzoic acid
  • Benzoic acid, 2-bromo-4-fluoro-5-nitro-
Found 5 products.