CAS 103639-57-2
:2-Piperidineethanol, (S)-
Description:
2-Piperidineethanol, (S)-, also known by its CAS number 103639-57-2, is a chiral amine characterized by the presence of a piperidine ring and a hydroxyl group attached to an ethyl chain. This compound exhibits properties typical of secondary amines, including the ability to participate in hydrogen bonding due to the hydroxyl group, which enhances its solubility in polar solvents. The (S)- designation indicates that it has a specific stereochemistry, which can influence its biological activity and interactions with other molecules. This compound is often utilized in pharmaceutical research and synthesis, particularly in the development of drugs due to its potential as a building block for more complex structures. Its chiral nature may also play a crucial role in determining the efficacy and safety profiles of the resulting pharmaceutical agents. Overall, 2-Piperidineethanol, (S)-, is significant in medicinal chemistry and related fields, where stereochemistry is critical for the desired biological effects.
Formula:C7H15NO
InChI:InChI=1S/C7H15NO/c9-6-4-7-3-1-2-5-8-7/h7-9H,1-6H2/t7-/m0/s1
SMILES:C1CCN[C@@H](C1)CCO
Synonyms:- (S)-2-Piperidineethanol
- (S)-(-)-Piperidine-2-ethanol
- (S)-2-(2-Hydroxyethyl)piperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-2-(Piperidin-2-yl)ethanol
CAS:(S)-2-(Piperidin-2-yl)ethanolFormula:C7H15NOPurity:97%Molecular weight:129.2(S)-2-(Piperidin-2-yl)ethanol
CAS:(S)-2-(Piperidin-2-yl)ethanolFormula:C7H15NOPurity:>97%Molecular weight:129.20009(S)-(-)-Piperidine-2-ethanol
CAS:Formula:C7H15NOPurity:97%Color and Shape:SolidMolecular weight:129.2001(S)-2-(Piperidin-2-yl)ethanol
CAS:Formula:C7H15NOPurity:95%Color and Shape:SolidMolecular weight:129.203(S)-2-Piperidineethanol
CAS:Controlled ProductApplications Useful in preparation of a novel class of pyrazolopyrimidines as inhibitors of protein and checkpoint kinases useful in treatment and prophylaxis of HCV infection and other diseases such as cancer.
References Huirne, J., et al.: Lancet, 358, 1793 (2001), Randolph, J., et al.: J. Med. Chem., 47, 1085 (2004), Rowbottom, M., et al.: Bioorg. Med. Chem. Lett.,14, 2269 (2004),Formula:C7H15NOColor and Shape:NeatMolecular weight:129.2




