CAS 1036454-35-9
:Piperidine,2-(3-ethyl-1,2,4-oxadiazol-5-yl)-
Description:
Piperidine, 2-(3-ethyl-1,2,4-oxadiazol-5-yl)- is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of the 3-ethyl-1,2,4-oxadiazol-5-yl group introduces a unique functionality, contributing to its potential biological activity and applications in medicinal chemistry. This compound typically exhibits properties associated with both the piperidine moiety, such as basicity and nucleophilicity, and the oxadiazole group, which may impart stability and influence reactivity. The structure suggests potential for interactions with biological targets, making it of interest in drug development. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of substituents. As with many heterocyclic compounds, it may also exhibit interesting pharmacological properties, warranting further investigation in the context of its synthesis and potential applications in pharmaceuticals or agrochemicals.
Formula:C9H15N3O
InChI:InChI=1S/C9H15N3O/c1-2-8-11-9(13-12-8)7-5-3-4-6-10-7/h7,10H,2-6H2,1H3
InChI key:CWZIRHZDSOSSKD-UHFFFAOYSA-N
SMILES:CCC1=NOC(=N1)C2CCCCN2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
