CAS 103646-20-4

Formula: C11H7NO4

InChI: InChI=1S/C11H7NO4/c12-11(16)7-8(13)5-3-1-2-4-6(5)9(14)10(7)15/h1-4,13H,(H2,12,16)

InChI key: YMZRQVHNKDYYLG-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C(=C(C(=O)C2=O)C(=O)N)O

2-Carbamoyl-3-hydroxy-1,4-naphthoquinone

CAS: 103646-20-4

Formula: C₁₁H₇NO₄

Purity: 95%~99%

Molecular weight: 217.18

Ref: BP-SBP03592

2-Carbamoyl-3-hydroxy-1,4-naphthoquinone

CAS: 103646-20-4

2-Carbamoyl-3-hydroxy-1,4-naphthoquinone is an organic compound, which is a synthetic derivative of naphthoquinone. Naphthoquinones are a class of organic compounds known for their diverse range of biological activities. This compound is synthesized through a series of chemical reactions involving the substitution of the naphthoquinone core structure. Its mode of action largely involves redox cycling and the generation of reactive oxygen species, which can lead to various biochemical effects within cellular environments.

Formula: C₁₁H₇NO₄

Purity: Min. 95%

Molecular weight: 217.18 g/mol

Ref: 3D-DEA64620