CAS 103646-82-8
:5-AMINO-1-(4-METHYLPHENYL)-1H-PYRAZOLE-4-CARBONITRILE
Description:
5-Amino-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a carbonitrile group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the 4-methylphenyl substituent enhances its lipophilicity, which may influence its biological activity and solubility properties. Typically, compounds of this nature are investigated for their potential as pharmaceuticals, particularly in the development of agents targeting various biological pathways. The CAS number 103646-82-8 uniquely identifies this substance in chemical databases, facilitating research and regulatory compliance. Its synthesis and characterization involve standard organic chemistry techniques, and it may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it a subject of interest in drug discovery and development. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H10N4
InChI:InChI=1/C11H10N4/c1-8-2-4-10(5-3-8)15-11(13)9(6-12)7-14-15/h2-5,7H,13H2,1H3
SMILES:Cc1ccc(cc1)n1c(c(C#N)cn1)N
Synonyms:- Buttpark 51\09-61
- 5-Amino-1-P-Tolyl-1H-Pyrazole-4-Carbonitrile
- 5-Amino-4-Cyano-1-(4-Methylphenyl)Pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Amino-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile
CAS:5-Amino-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrileFormula:C11H10N4Purity:≥95%Color and Shape:Solid-PowderMolecular weight:198.223895-Amino-1-(4-methylphenyl)-1H-pyrazole-4-carbonitrile
CAS:Formula:C11H10N4Purity:95%Color and Shape:SolidMolecular weight:198.22395-Amino-1-(p-tolyl)pyrazole-4-carbonitrile
CAS:Formula:C11H10N4Purity:>93.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:198.235-Amino-1-(p-tolyl)-1H-pyrazole-4-carbonitrile
CAS:5-Amino-1-(p-tolyl)-1H-pyrazole-4-carbonitrileFormula:C11H10N4Purity:97%Molecular weight:198.225-Amino-1-(p-tolyl)-1H-pyrazole-4-carbonitrile
CAS:Formula:C11H10N4Purity:95%Molecular weight:198.2295-Amino-1-(p-tolyl)pyrazole-4-carbonitrile
CAS:5-Amino-1-(p-tolyl)pyrazole-4-carbonitrile is a cytotoxic agent that inhibits the activation of plasminogen by urokinase. It has been shown to inhibit cancer growth in lung carcinoma cells and breast cancer cells. 5-Amino-1-(p-tolyl)pyrazole-4-carbonitrile also inhibits the proliferation of liver cancer cells and MDA-MB231 breast carcinoma cell lines. The anticancer activity of 5-amino pyrazole can be enhanced by the addition of doxorubicin, which is an anticancer drug that acts on DNA synthesis and cell division.Formula:C11H10N4Purity:Min. 95%Molecular weight:198.23 g/mol





