CymitQuimica logo

CAS 1036588-32-5

:

4-Isopropoxy-3-methoxybenzyl chloride

Description:
4-Isopropoxy-3-methoxybenzyl chloride is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both isopropoxy and methoxy groups, as well as a chlorine atom. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. Its molecular structure suggests it may exhibit moderate polarity due to the presence of ether and chloro functional groups. The presence of the chlorine atom makes it a potential electrophile, which can participate in nucleophilic substitution reactions. Additionally, the isopropoxy and methoxy groups can influence its reactivity and solubility, making it of interest in synthetic organic chemistry. This compound may be utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 4-Isopropoxy-3-methoxybenzyl chloride is a versatile compound with significant potential in chemical synthesis.
Formula:C11H15ClO2
InChI:InChI=1S/C11H15ClO2/c1-8(2)14-10-5-4-9(7-12)6-11(10)13-3/h4-6,8H,7H2,1-3H3
InChI key:WFMQREQRKYROEM-UHFFFAOYSA-N
SMILES:CC(C)OC1=C(C=C(C=C1)CCl)OC
Found 1 products.