CymitQuimica logo

CAS 1036756-04-3

:

6-Amino-3-bromo-2-fluorobenzenemethanol

Description:
6-Amino-3-bromo-2-fluorobenzenemethanol is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a bromine atom, and a fluorine atom, along with a hydroxymethyl group. The presence of the amino group (-NH2) suggests that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine and fluorine substituents introduce halogen reactivity, which can be exploited in further synthetic applications. This compound is likely to exhibit polar characteristics due to the hydroxymethyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the presence of multiple functional groups may impart biological activity, making it of interest in medicinal chemistry. Its specific reactivity and stability would depend on the surrounding conditions, such as pH and temperature. Overall, 6-Amino-3-bromo-2-fluorobenzenemethanol is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C7H7BrFNO
InChI:InChI=1S/C7H7BrFNO/c8-5-1-2-6(10)4(3-11)7(5)9/h1-2,11H,3,10H2
InChI key:InChIKey=FTGNJLGMELWIIK-UHFFFAOYSA-N
SMILES:C(O)C1=C(F)C(Br)=CC=C1N
Synonyms:
  • 6-Amino-3-bromo-2-fluorobenzenemethanol
  • Benzenemethanol, 6-amino-3-bromo-2-fluoro-
  • (6-Amino-3-bromo-2-fluorophenyl)methanol
Found 3 products.