CymitQuimica logo

CAS 1036757-40-0

:

Benzamide, 3-amino-5-fluoro-

Description:
Benzamide, 3-amino-5-fluoro- is an organic compound characterized by the presence of an amide functional group attached to a benzene ring, along with an amino group and a fluorine atom at specific positions on the aromatic ring. The molecular structure features a benzene ring substituted at the meta position with an amino group (-NH2) and at the para position with a fluorine atom (F), which influences its chemical reactivity and physical properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the amide and amino groups. Its fluorine substitution can enhance lipophilicity and alter biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the amino group may allow for hydrogen bonding, affecting its interaction with other molecules. Overall, Benzamide, 3-amino-5-fluoro- is significant in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of various bioactive compounds.
Formula:C7H7FN2O
InChI:InChI=1S/C7H7FN2O/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,9H2,(H2,10,11)
InChI key:XEBNJYARAWCSGJ-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1N)F)C(=O)N
Synonyms:
  • 3-Amino-5-fluorobenzamide
  • [2-(Diisopropylcarbamoyl)phenyl]boronic acid
  • Benzamide, 3-amino-5-fluoro-
Found 3 products.