CymitQuimica logo

CAS 1036760-03-8

:

[3-(1-hydroxyethyl)phenyl]boronic acid

Description:
[3-(1-hydroxyethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a hydroxyethyl substituent. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The hydroxyethyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's structure suggests potential applications in drug development, particularly in the design of inhibitors for certain enzymes, as well as in materials science for the development of sensors and catalysts. Overall, [3-(1-hydroxyethyl)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C8H11BO3
InChI:InChI=1S/C8H11BO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-6,10-12H,1H3
InChI key:HMEWBULOTJOSEI-UHFFFAOYSA-N
SMILES:CC(c1cccc(c1)B(O)O)O
Synonyms:
  • 3-(1-Hydroxyethyl)phenylboronic acid
Found 4 products.