CymitQuimica logo

CAS 10368-44-2

:

trans-2-bromo-1-indanol

Description:
Trans-2-bromo-1-indanol is an organic compound characterized by its bromine substituent and hydroxyl group attached to an indane structure. It features a trans configuration, indicating that the bromine and hydroxyl groups are positioned on opposite sides of the indane ring system. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic indane core. The presence of the bromine atom contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. Additionally, the hydroxyl group imparts some degree of polarity, influencing its chemical behavior and interactions. Trans-2-bromo-1-indanol can be utilized in the synthesis of pharmaceuticals and other complex organic molecules, showcasing its significance in medicinal chemistry and materials science. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated organic substances.
Formula:C9H9BrO
InChI:InChI=1/C9H9BrO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5H2/t8-,9-/m0/s1
InChI key:RTESDSDXFLYAKZ-RKDXNWHRSA-N
SMILES:c1ccc2c(c1)C[C@@H]([C@H]2O)Br
Synonyms:
  • (1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol
  • (1S,2S)-2-bromo-2,3-dihydro-1H-inden-1-ol
Found 3 products.