CymitQuimica logo

CAS 10368-73-7

:

2-bromo-1,3,5-triphenyl-benzene

Description:
2-Bromo-1,3,5-triphenyl-benzene is an organic compound characterized by its complex structure, which includes a bromine atom and three phenyl groups attached to a central benzene ring. This compound belongs to the class of polycyclic aromatic hydrocarbons and exhibits notable hydrophobic properties due to its extensive aromatic character. The presence of the bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution and cross-coupling reactions. Additionally, the compound may exhibit interesting optical properties, which can be leveraged in materials science and organic electronics. Its molecular structure contributes to its stability, although the bromine atom can introduce sites for further functionalization. As with many brominated compounds, it is essential to handle 2-bromo-1,3,5-triphenyl-benzene with care due to potential environmental and health impacts associated with brominated organic compounds. Overall, this compound serves as a valuable building block in organic synthesis and materials chemistry.
Formula:C24H17Br
InChI:InChI=1/C24H17Br/c25-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20/h1-17H
InChI key:JQAGNDRJKSDTEU-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cc(c2ccccc2)c(c(c1)c1ccccc1)Br
Synonyms:
  • 2-Bromo-1,3,5-triphenylbenzene
Found 5 products.