CymitQuimica logo

CAS 103686-16-4

:

(2E)-3-(4-Bromo-2-thienyl)-2-propenoic acid

Description:
(2E)-3-(4-Bromo-2-thienyl)-2-propenoic acid is an organic compound characterized by its unique structural features, which include a propenoic acid backbone and a brominated thienyl group. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential applications in organic synthesis. The thienyl ring, a five-membered aromatic heterocycle containing sulfur, contributes to the compound's stability and electronic properties. This compound is likely to exhibit both acidic and electrophilic characteristics due to the carboxylic acid functional group, making it a candidate for various chemical reactions, including esterification and coupling reactions. Its structural configuration, particularly the (2E) designation, indicates a specific geometric arrangement around the double bond, which can affect its biological activity and interaction with other molecules. Overall, (2E)-3-(4-Bromo-2-thienyl)-2-propenoic acid is of interest in fields such as medicinal chemistry and materials science, where its unique properties can be harnessed for the development of new compounds or materials.
Formula:C7H5BrO2S
InChI:InChI=1S/C7H5BrO2S/c8-5-3-6(11-4-5)1-2-7(9)10/h1-4H,(H,9,10)/b2-1+
InChI key:InChIKey=VHKFUECAKTYKCR-OWOJBTEDSA-N
SMILES:C(=C/C(O)=O)\C1=CC(Br)=CS1
Synonyms:
  • (2E)-3-(4-Bromo-2-thienyl)-2-propenoic acid
  • (2E)-3-(4-Bromo-2-thienyl)acrylic acid
  • 2-Propenoic acid, 3-(4-bromo-2-thienyl)-, (E)-
  • 2-Propenoic acid, 3-(4-bromo-2-thienyl)-, (2E)-
Found 2 products.