CymitQuimica logo

CAS 103686-55-1

:

Methanone, (4-chlorophenyl)-5-pyrimidinyl-

Description:
Methanone, (4-chlorophenyl)-5-pyrimidinyl- is an organic compound characterized by its specific functional groups and structural features. It contains a methanone (ketone) functional group, which is indicative of a carbonyl group (C=O) bonded to a carbon atom. The presence of a 4-chlorophenyl group suggests that there is a phenyl ring substituted with a chlorine atom at the para position, contributing to its aromatic properties. Additionally, the compound features a pyrimidine ring, a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. This combination of aromatic and heterocyclic components often imparts unique chemical reactivity and biological activity. The compound may exhibit properties such as lipophilicity due to its aromatic nature, and it could potentially interact with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, including solubility, melting point, and reactivity, would depend on the overall molecular structure and the interactions between its functional groups.
Formula:C11H7ClN2O
InChI:InChI=1S/C11H7ClN2O/c12-10-3-1-8(2-4-10)11(15)9-5-13-7-14-6-9/h1-7H
InChI key:InChIKey=ZDWRULLIEOEBRC-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(Cl)C=C1)C=2C=NC=NC2
Synonyms:
  • (4-Chlorophenyl)(pyrimidin-5-yl)methanone
  • Methanone, (4-chlorophenyl)-5-pyrimidinyl-
  • (4-Chlorophenyl)-5-pyrimidinylmethanone
Found 1 products.