CymitQuimica logo

CAS 1036931-21-1

:

(2-Nitroethyl)cyclobutane

Description:
(2-Nitroethyl)cyclobutane is an organic compound characterized by its cyclobutane ring structure substituted with a nitroethyl group. The presence of the nitro group (-NO2) introduces significant polarity and reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. The cyclobutane moiety contributes to the compound's unique strain and conformational properties, which can influence its reactivity and stability. Typically, compounds like (2-Nitroethyl)cyclobutane exhibit moderate solubility in polar organic solvents due to the nitro group, while their boiling and melting points can vary based on the specific interactions between the cyclobutane ring and the nitroethyl substituent. Additionally, the compound may exhibit interesting spectroscopic properties, making it suitable for analytical studies. Safety considerations are essential when handling this compound, as nitro compounds can be sensitive to heat and shock, and may pose health risks if inhaled or ingested. Overall, (2-Nitroethyl)cyclobutane represents a valuable structure in organic synthesis and materials science.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c8-7(9)5-4-6-2-1-3-6/h6H,1-5H2
InChI key:InChIKey=TWARFNMZHLVGMX-UHFFFAOYSA-N
SMILES:C(CN(=O)=O)C1CCC1
Synonyms:
  • (2-Nitroethyl)cyclobutane
  • Cyclobutane, (2-nitroethyl)-
  • 2-(Cyclobutyl)-1-nitroethane
Found 2 products.