CymitQuimica logo

CAS 1037206-84-0

:

2-Amino-4-fluoro-5-methylaniline

Description:
2-Amino-4-fluoro-5-methylaniline, with the CAS number 1037206-84-0, is an organic compound that belongs to the class of anilines, which are aromatic amines. This substance features an amino group (-NH2), a fluorine atom, and a methyl group (-CH3) attached to a benzene ring, contributing to its unique chemical properties. The presence of the amino group makes it a basic compound, while the fluorine atom introduces electronegativity, influencing its reactivity and solubility in various solvents. Typically, compounds like this exhibit moderate to high polarity due to the functional groups present. It may be used in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, or agrochemicals. Safety data should be consulted for handling, as anilines can be toxic and may pose environmental hazards. Overall, 2-Amino-4-fluoro-5-methylaniline is characterized by its functional groups, which dictate its chemical behavior and potential applications in organic synthesis.
Formula:C8H7FN2
InChI:InChI=1S/C8H7FN2/c1-5-2-6(4-10)8(11)3-7(5)9/h2-3H,11H2,1H3
InChI key:YAEPXRRKVAJHHQ-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1F)N)C#N
Found 3 products.