CymitQuimica logo

CAS 1037206-86-2

:

Methyl 2-amino-4-fluoro-5-methylbenzoate

Description:
Methyl 2-amino-4-fluoro-5-methylbenzoate, with the CAS number 1037206-86-2, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group, an amino group, and a fluorine atom, which contribute to its unique chemical properties. The presence of the amino group indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The fluorine atom introduces electronegativity, which can influence the compound's reactivity and stability. This compound is likely to exhibit moderate lipophilicity due to the aromatic ring and alkyl substituents, making it of interest in medicinal chemistry and drug design. Its structural characteristics may also suggest potential applications in the synthesis of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.
Formula:C9H10FNO2
InChI:InChI=1S/C9H10FNO2/c1-5-3-6(9(12)13-2)8(11)4-7(5)10/h3-4H,11H2,1-2H3
InChI key:InChIKey=JCKAXUVEWBQECT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N)C=C(F)C(C)=C1
Synonyms:
  • Methyl 2-amino-4-fluoro-5-methylbenzoate
  • Benzoic acid, 2-amino-4-fluoro-5-methyl-, methyl ester
Found 3 products.