CAS 1037210-93-7
:Patidegib
Description:
Patidegib is a small molecule inhibitor primarily targeting the Hedgehog signaling pathway, which plays a crucial role in cell growth and differentiation. It is particularly noted for its application in treating basal cell carcinoma and other tumors associated with aberrant Hedgehog signaling. The substance is characterized by its ability to selectively inhibit Smoothened, a key component of the Hedgehog pathway, thereby disrupting the signaling cascade that leads to tumor proliferation. Patidegib is typically administered topically, which allows for localized treatment with potentially reduced systemic side effects. Its chemical structure includes specific functional groups that contribute to its binding affinity and selectivity for the target protein. As a therapeutic agent, Patidegib has undergone various clinical trials to evaluate its efficacy and safety profile, demonstrating promise in oncology. However, like many targeted therapies, it may also present challenges such as resistance mechanisms in tumor cells, necessitating ongoing research to optimize its use in clinical settings.
Formula:C29H48N2O3S
InChI:InChI=1S/C29H48N2O3S/c1-17-12-26-27(30-16-17)19(3)29(34-26)11-9-22-23-7-6-20-13-21(31-35(5,32)33)8-10-28(20,4)25(23)14-24(22)18(2)15-29/h17,19-23,25-27,30-31H,6-16H2,1-5H3/t17-,19+,20+,21+,22-,23-,25-,26+,27-,28-,29-/m0/s1
InChI key:InChIKey=HZLFFNCLTRVYJG-WWGOJCOQSA-N
SMILES:C[C@H]1[C@@]2(O[C@]3([C@]1(NC[C@@H](C)C3)[H])[H])CC(C)=C4[C@@](CC2)([C@]5([C@](C4)([C@]6(C)[C@](CC5)(C[C@H](NS(C)(=O)=O)CC6)[H])[H])[H])[H]
Synonyms:- Methanesulfonamide, N-[(2S,3R,3′R,3aS,4′aR,6S,6′aR,6′bS,7aR,12′aS,12′bS)-2′,3′,3a,4,4′,4′a,5,5′,6,6′,6′a,6′b,7,7′,7a,8′,10′,12′,12′a,12′b-eicosahydro-3,6,11′,12′b-tetramethylspiro[furo[3,2-b]pyridine-2(3H),9′(1′H)-naphth[2,1-a]azulen]-3′-yl]-
- FIN 5
- IP 9
- N-[(2S,3R,3′R,3aS,4′aR,6S,6′aR,6′bS,7aR,12′aS,12′bS)-2′,3′,3a,4,4′,4′a,5,5′,6,6′,6′a,6′b,7,7′,7a,8′,10′,12′,12′a,12′b-Eicosahydro-3,6,11′,12′b-tetramethylspiro[furo[3,2-b]pyridine-2(3H),9′(1′H)-naphth[2,1-a]azulen]-3′-yl]methanesulfonamide
- IPI 926
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Saridegib
CAS:Saridegib is an effective and specific inhibitor of Smoothened and a key signaling transmembrane protein in the Hedgehog pathway.Formula:C29H48N2O3SPurity:98%Color and Shape:SolidMolecular weight:504.77Saridegib
CAS:Saridegib is a novel, potent and selective inhibitor of the protein kinase C-epsilon (PKC-epsilon). Saridegib has been shown to inhibit the activity of PKC-epsilon in vitro. PKC-epsilon is expressed in high levels in metastatic pancreatic cancer cells, which are resistant to conventional chemotherapy. Saridegib inhibits cancer cell growth and survival by blocking the production of inflammatory cytokines such as interleukin-1beta (IL-1β) and tumor necrosis factor alpha (TNFα). Saridegib also inhibits human skin cancer cells by inhibiting the production of IL-8 and TNFα. This drug has also been shown to be effective against inflammatory diseases such as rheumatoid arthritis and psoriasis.Formula:C29H48N2O3SPurity:Min. 95%Molecular weight:504.8 g/mol



