CymitQuimica logo

CAS 103724-99-8

:

4-Chloro-2,6-diMethylbromo benzene

Description:
4-Chloro-2,6-dimethylbromobenzene is an aromatic compound characterized by the presence of a bromine atom, a chlorine atom, and two methyl groups attached to a benzene ring. The molecular structure features a bromine substituent at the 1-position, a chlorine substituent at the 4-position, and two methyl groups at the 2 and 6 positions of the benzene ring, contributing to its overall reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The presence of halogen atoms enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, due to its halogenated nature, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. As with many halogenated compounds, it is important to consider its potential toxicity and environmental impact during use and disposal.
Formula:C8H8BrCl
InChI:InChI=1S/C8H8BrCl/c1-5-3-7(10)4-6(2)8(5)9/h3-4H,1-2H3
InChI key:CFMPIQSLDJXNPD-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1Br)C)Cl
Synonyms:
  • 1-Bromo-4-Chloro-2,6-Dimethylbenzene
Found 5 products.