CymitQuimica logo

CAS 1037298-12-6

:

Phenol,2-amino-4-bromo-5-fluoro-, hydrochloride (1:1)

Description:
Phenol, 2-amino-4-bromo-5-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its aromatic structure, which includes a phenolic group and various substituents that contribute to its reactivity and properties. The presence of an amino group (-NH2) indicates potential basicity and the ability to participate in hydrogen bonding, while the bromo (-Br) and fluoro (-F) substituents introduce halogen functionalities that can influence the compound's electronic properties and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Additionally, its molecular interactions can be affected by the presence of the halogen atoms, which can modulate its lipophilicity and overall stability. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks.
Formula:C6H5BrFNO・ClH
InChI:InChI=1S/C6H5BrFNO.ClH/c7-3-1-5(9)6(10)2-4(3)8;/h1-2,10H,9H2;1H
InChI key:CXNQELBTUKLEBK-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1Br)F)O)N.Cl
Found 1 products.