CymitQuimica logo

CAS 1037298-16-0

:

2-amino-4,5-dibromophenol

Description:
2-Amino-4,5-dibromophenol is an organic compound characterized by the presence of an amino group and two bromine substituents on a phenolic ring. Its molecular structure features a phenol group, which contributes to its reactivity and potential applications in various chemical processes. The amino group (-NH2) enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its chemical behavior. The bromine atoms, being electronegative, can affect the compound's reactivity, making it a potential candidate for electrophilic substitution reactions. This compound may exhibit biological activity, which could be of interest in pharmaceutical research. Additionally, its properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. As with many brominated compounds, it is essential to handle 2-amino-4,5-dibromophenol with care due to potential toxicity and environmental concerns associated with brominated organic substances.
Formula:C6H5Br2NO
InChI:InChI=1S/C6H5Br2NO/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H,9H2
InChI key:FLJGRKJRMHAKMV-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1Br)Br)O)N
Found 2 products.