CymitQuimica logo

CAS 10374-07-9

:

3-Oxabicyclo[3.2.0]hept-6-ene-2,4-dione

Description:
3-Oxabicyclo[3.2.0]hept-6-ene-2,4-dione, also known by its CAS number 10374-07-9, is a bicyclic compound characterized by a unique structure that includes a fused bicyclic framework with an oxygen atom incorporated into the ring system. This compound features two carbonyl (C=O) functional groups located at the 2 and 4 positions of the bicyclic structure, contributing to its reactivity and potential applications in organic synthesis. The presence of the oxabicyclic system imparts distinctive chemical properties, such as the ability to undergo various reactions typical of carbonyl compounds, including nucleophilic addition and cycloaddition reactions. Additionally, the compound's structural features may influence its physical properties, such as solubility and boiling point, making it of interest in fields like medicinal chemistry and materials science. Its reactivity and structural characteristics make it a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C6H4O3
InChI:InChI=1S/C6H4O3/c7-5-3-1-2-4(3)6(8)9-5/h1-4H
InChI key:XREQZAHSEPNASW-UHFFFAOYSA-N
SMILES:C1=CC2C1C(=O)OC2=O
Synonyms:
  • 3-Cyclobutene-1,2-dicarboxylicanhydride (7CI,8CI)
  • 1-Cyclobutene-3,4-dicarboxylic anhydride
  • 1-Cyclobutene-cis-3,4-dicarboxylic anhydride
  • 3-Cyclobutene-cis-1,2-dicarboxylic anhydride
  • Cyclobut-3-ene-1,2-dicarboxylicacid anhydride
  • cis-3,4-Cyclobutenedicarboxylic anhydride
Found 2 products.