CymitQuimica logo

CAS 103740-34-7

:

4-(3-AMINO-PHENYL)-THIAZOL-2-YLAMINE

Description:
4-(3-Amino-phenyl)-thiazol-2-ylamine, identified by its CAS number 103740-34-7, is an organic compound characterized by the presence of both thiazole and an amino group attached to a phenyl ring. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its unique chemical properties. The amino group (-NH2) enhances its reactivity and solubility in polar solvents, making it useful in various chemical reactions and applications. The presence of the phenyl group provides aromatic stability and can influence the compound's electronic properties. This substance may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways. As with many thiazole derivatives, it may also possess properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would require further investigation. Proper handling and safety measures should be observed due to its chemical nature.
Formula:C9H9N3S
InChI:InChI=1/C9H9N3S/c10-7-3-1-2-6(4-7)8-5-13-9(11)12-8/h1-5H,10H2,(H2,11,12)
InChI key:NCWQWEQGANDQFS-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N)c1csc(=N)[nH]1
Synonyms:
  • 4-(3-Aminophenyl)-1,3-Thiazol-2-Amine
Found 4 products.