CymitQuimica logo

CAS 10375-34-5

:

2,5-Furandicarbonyldichloride(9CI)

Description:
2,5-Furandicarbonyldichloride, also known by its CAS number 10375-34-5, is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two carbonyl (C=O) groups and two chlorine atoms attached to the furan ring, making it a versatile building block in organic synthesis. It is typically a colorless to pale yellow liquid with a pungent odor, and it is known for its reactivity, particularly in acylation reactions. The presence of the dichloride functional groups allows it to participate in nucleophilic substitution reactions, making it useful in the synthesis of various derivatives and polymers. 2,5-Furandicarbonyldichloride is often handled with care due to its potential to release corrosive hydrochloric acid upon hydrolysis. It is primarily used in the production of agrochemicals, pharmaceuticals, and as an intermediate in the synthesis of other organic compounds. Proper safety measures should be observed when working with this compound due to its reactive nature and potential health hazards.
Formula:C6H2Cl2O3
InChI:InChI=1S/C6H2Cl2O3/c7-5(9)3-1-2-4(11-3)6(8)10/h1-2H
InChI key:PDSULNVJASBMLP-UHFFFAOYSA-N
SMILES:C1=C(OC(=C1)C(=O)Cl)C(=O)Cl
Found 5 products.