CAS 103750-03-4

2,5-Dioxo-1-pyrrolidinyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-pentanoate

Description:

2,5-Dioxo-1-pyrrolidinyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-pentanoate, identified by its CAS number 103750-03-4, is a chemical compound that belongs to the class of pyrrole derivatives. This substance features a complex structure characterized by multiple functional groups, including dioxo and pyrrolidinyl moieties, which contribute to its reactivity and potential applications in various fields, such as pharmaceuticals and materials science. The presence of the pentanoate group suggests that it may exhibit ester-like properties, influencing its solubility and interaction with biological systems. Additionally, the dioxo groups indicate potential for hydrogen bonding and reactivity in organic synthesis. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit interesting biological activities, making them subjects of research in medicinal chemistry. Overall, the unique structural features of this compound may lead to diverse applications, warranting further investigation into its properties and potential uses.

Formula: C₁₃H₁₄N₂O₆

InChI: InChI=1S/C13H14N2O6/c16-9-4-5-10(17)14(9)8-2-1-3-13(20)21-15-11(18)6-7-12(15)19/h4-5H,1-3,6-8H2

InChI key: InChIKey=ULZJAHZPCLFGHQ-UHFFFAOYSA-N

SMILES: O(C(CCCCN1C(=O)C=CC1=O)=O)N2C(=O)CCC2=O

Synonyms:

• 1H-Pyrrole-1-pentanoic acid, 2,5-dihydro-2,5-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester
• 1H-Pyrrole-2,5-dione, 1-[5-[(2,5-dioxo-1-pyrrolidinyl)oxy]-5-oxopentyl]-
• 1H-Pyrrole-2,5-dione,1-[5-[(2,5-dioxo-1-pyrrolidinyl)oxy]-5-oxopentyl]- (9CI)
• 2,5-Dioxo-1-pyrrolidinyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-pentanoate
• 2,5-Dioxopyrrolidin-1-yl 5-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoate

5-Maleimidovalericacid-NHS

CAS: 103750-03-4

Formula: C₁₃H₁₄N₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.2601

Ref: IN-DA003G0S

Mal-C2-NHS ester

CAS: 103750-03-4

Mal-C2-NHS ester

Purity: 98%

Molecular weight: 294.26g/mol

Ref: 54-OR1031855

Mal-C2-NHS ester

CAS: 103750-03-4

Mal-C2-NHS ester is a noncleavable linker compound commonly employed for the synthesis of antibody-drug conjugates (ADCs)[1].

Formula: C₁₃H₁₄N₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.2601

Ref: TM-T18248

5-Maleimidovaleric acid-NHS

CAS: 103750-03-4

Formula: C₁₃H₁₄N₂O₆

Purity: ≥98%

Molecular weight: 294.263

Ref: 10-F494211