CymitQuimica logo

CAS 103750-03-4

:

2,5-Dioxo-1-pyrrolidinyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-pentanoate

Description:
2,5-Dioxo-1-pyrrolidinyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-pentanoate, identified by its CAS number 103750-03-4, is a chemical compound that belongs to the class of pyrrole derivatives. This substance features a complex structure characterized by multiple functional groups, including dioxo and pyrrolidinyl moieties, which contribute to its reactivity and potential applications in various fields, such as pharmaceuticals and materials science. The presence of the pentanoate group suggests that it may exhibit ester-like properties, influencing its solubility and interaction with biological systems. Additionally, the dioxo groups indicate potential for hydrogen bonding and reactivity in organic synthesis. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit interesting biological activities, making them subjects of research in medicinal chemistry. Overall, the unique structural features of this compound may lead to diverse applications, warranting further investigation into its properties and potential uses.
Formula:C13H14N2O6
InChI:InChI=1S/C13H14N2O6/c16-9-4-5-10(17)14(9)8-2-1-3-13(20)21-15-11(18)6-7-12(15)19/h4-5H,1-3,6-8H2
InChI key:InChIKey=ULZJAHZPCLFGHQ-UHFFFAOYSA-N
SMILES:O(C(CCCCN1C(=O)C=CC1=O)=O)N2C(=O)CCC2=O
Synonyms:
  • 1H-Pyrrole-1-pentanoic acid, 2,5-dihydro-2,5-dioxo-, 2,5-dioxo-1-pyrrolidinyl ester
  • 1H-Pyrrole-2,5-dione, 1-[5-[(2,5-dioxo-1-pyrrolidinyl)oxy]-5-oxopentyl]-
  • 1H-Pyrrole-2,5-dione,1-[5-[(2,5-dioxo-1-pyrrolidinyl)oxy]-5-oxopentyl]- (9CI)
  • 2,5-Dioxo-1-pyrrolidinyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-pentanoate
  • 2,5-Dioxopyrrolidin-1-yl 5-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoate
Found 5 products.