CymitQuimica logo

CAS 1037624-75-1

:

BGB 324

Description:
BGB-324, with the CAS number 1037624-75-1, is a small molecule that functions primarily as a selective inhibitor of the enzyme Bruton’s tyrosine kinase (BTK). This compound has garnered attention in the field of medicinal chemistry and pharmacology, particularly for its potential therapeutic applications in treating various hematological malignancies and autoimmune diseases. BGB-324 exhibits a high degree of specificity for BTK, which plays a crucial role in B-cell receptor signaling and is implicated in the pathogenesis of certain cancers. The compound's mechanism of action involves the disruption of BTK-mediated signaling pathways, leading to the inhibition of cell proliferation and survival in malignant B cells. In terms of its physical and chemical properties, BGB-324 is characterized by its molecular structure, which includes specific functional groups that contribute to its biological activity. Ongoing research continues to explore its efficacy, safety profile, and potential combination therapies in clinical settings.
Formula:C30H34N8
InChI:InChI=1S/C30H34N8/c31-29-33-30(32-24-13-10-20-11-14-25(15-12-22(20)18-24)37-16-3-4-17-37)36-38(29)27-19-23-8-5-7-21-6-1-2-9-26(21)28(23)35-34-27/h1-2,6,9-10,13,18-19,25H,3-5,7-8,11-12,14-17H2,(H3,31,32,33,36)/t25-/m0/s1
InChI key:InChIKey=KXMZDGSRSGHMMK-VWLOTQADSA-N
SMILES:NC=1N(C=2C=C3C(C=4C(CCC3)=CC=CC4)=NN2)N=C(NC=5C=C6C(=CC5)CC[C@@H](CC6)N7CCCC7)N1
Synonyms:
  • BGB 324
  • 1-(6,7-Dihydro-5H-benzo[6,7]cyclohepta[1,2-c]pyridazin-3-yl)-N3-[(7-(S)-pyrrolidin-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulene-2-yl]-1H-1,2,4-triazole-3,5-diamine
  • 1-(6,7-Dihydro-5H-benzo[6,7]cyclohepta[1,2-c]pyridazin-3-yl)-N3-[(7S)-6,7,8,9-tetrahydro-7-(1-pyrrolidinyl)-5H-benzocyclohepten-2-yl]-1H-1,2,4-triazole-3,5-diamine
  • R 428
  • 1H-1,2,4-Triazole-3,5-diamine, 1-(6,7-dihydro-5H-benzo[6,7]cyclohepta[1,2-c]pyridazin-3-yl)-N3-[(7S)-6,7,8,9-tetrahydro-7-(1-pyrrolidinyl)-5H-benzocyclohepten-2-yl]-
Found 7 products.