CAS 103763-87-7
:Ethanol, 2-[(2-aminophenyl)methylamino]-
Description:
Ethanol, 2-[(2-aminophenyl)methylamino]-, also known by its CAS number 103763-87-7, is a chemical compound that features both an ethanol backbone and an amino group attached to a phenyl ring. This compound is characterized by its amine functionality, which can participate in hydrogen bonding, influencing its solubility and reactivity. The presence of the ethanol group suggests that it is likely to be a polar molecule, enhancing its solubility in water and other polar solvents. The amino group can also impart basic properties, allowing it to interact with acids and participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound may exhibit biological activity due to the presence of the amino group and the aromatic ring, which can influence its interaction with biological systems. Overall, this compound's unique structure combines features of both alcohols and amines, making it of interest in various fields, including medicinal chemistry and materials science.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-11(6-7-12)9-5-3-2-4-8(9)10/h2-5,12H,6-7,10H2,1H3
InChI key:PGHNSQXARUHJTQ-UHFFFAOYSA-N
SMILES:CN(CCO)C1=CC=CC=C1N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
