CymitQuimica logo

CAS 103765-33-9

:

2,4-Thiophenedicarboxylic acid, 5-amino-3-methyl-, dimethyl ester

Description:
2,4-Thiophenedicarboxylic acid, 5-amino-3-methyl-, dimethyl ester is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features two carboxylic acid groups that are esterified with methyl groups, enhancing its solubility and reactivity. The presence of an amino group at the 5-position and a methyl group at the 3-position of the thiophene ring contributes to its unique chemical properties, including potential for hydrogen bonding and increased steric hindrance. This compound is likely to exhibit moderate polarity due to the functional groups, making it suitable for various chemical reactions, including esterification and amidation. It may also have applications in organic synthesis, pharmaceuticals, or materials science, particularly in the development of dyes or agrochemicals. As with many thiophene derivatives, it may exhibit interesting electronic properties, making it a candidate for studies in organic electronics or as a building block in more complex molecular architectures.
Formula:C9H11NO4S
InChI:InChI=1/C9H11NO4S/c1-4-5(8(11)13-2)7(10)15-6(4)9(12)14-3/h10H2,1-3H3
InChI key:JNLHLSOENLVUIJ-UHFFFAOYSA-N
SMILES:Cc1c(c(N)sc1C(=O)OC)C(=O)OC
Synonyms:
  • Dimethyl 5-Amino-3-Methylthiophene-2,4-Dicarboxylate
Found 3 products.