CymitQuimica logo

CAS 10378-08-2

:

Hexanoic acid, 3-oxo-6-(phenylmethoxy)-, ethyl ester

Description:
Hexanoic acid, 3-oxo-6-(phenylmethoxy)-, ethyl ester, with the CAS number 10378-08-2, is an organic compound that belongs to the class of esters. It features a hexanoic acid backbone, which is a six-carbon saturated fatty acid, modified by the presence of a ketone group at the 3-position and a phenylmethoxy group at the 6-position. This structure imparts unique chemical properties, including potential reactivity due to the carbonyl group and the ability to participate in various chemical reactions such as esterification and hydrolysis. The ethyl ester form suggests that it is likely to be a liquid at room temperature, with a characteristic fruity or sweet odor typical of many esters. Its solubility in organic solvents and limited solubility in water is expected, making it useful in various applications, including as a flavoring agent, fragrance, or in organic synthesis. Safety data should be consulted for handling and potential hazards, as with any chemical substance.
Formula:C15H20O4
InChI:InChI=1S/C15H20O4/c1-2-19-15(17)11-14(16)9-6-10-18-12-13-7-4-3-5-8-13/h3-5,7-8H,2,6,9-12H2,1H3
InChI key:ZGGLXDWYBLNMDD-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(=O)CCCOCC1=CC=CC=C1
Found 3 products.