CAS 1037834-62-0

6-Azaspiro[2.5]octane hydrochloride

Description:

6-Azaspiro[2.5]octane hydrochloride is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework containing a nitrogen atom. This compound features a six-membered ring fused to a five-membered ring, contributing to its rigidity and potential biological activity. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical research. The presence of the nitrogen atom in the spiro structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's molecular interactions, stability, and reactivity can be influenced by its stereochemistry and functional groups. As with many nitrogen-containing heterocycles, it may exhibit a range of biological activities, including potential effects on neurotransmitter systems. However, detailed studies are necessary to fully elucidate its properties and potential applications in drug development or other fields.

Formula: C₇H₁₄ClN

InChI: InChI=1S/C7H13N.ClH/c1-2-7(1)3-5-8-6-4-7;/h8H,1-6H2;1H

InChI key: IDGDUKPISDZPDY-UHFFFAOYSA-N

SMILES: C1CC12CCNCC2.Cl

Synonyms:

• 6-Azaspiro[2.5]octane hydrochloride

6-Azaspiro[2.5]octane hydrochloride

CAS: 1037834-62-0

6-Azaspiro[2.5]octane hydrochloride

Formula: C₇H₁₃N·ClH

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.64575

Ref: 54-OR312258

6-Azaspiro[2.5]octane Hydrochloride

CAS: 1037834-62-0

Formula: C₇H₁₄ClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.6458

Ref: IN-DA008Z29

6-Azaspiro[2.5]octane HCl

CAS: 1037834-62-0

6-Azaspiro[2.5]octane hydrochloride

Formula: C₇H₁₄ClN

Purity: 98%

Molecular weight: 147.65

Ref: IN-DG229174

6-Azaspiro[2.5]octane hydrochloride

CAS: 1037834-62-0

6-Azaspiro[2.5]octane hydrochloride is a high quality, reagent, complex compound that is useful as an intermediate in the synthesis of various organic compounds. CAS No. 1037834-62-0 is a fine chemical with many applications including use as a building block and scaffold for speciality chemicals such as research chemicals and versatile building blocks for reactions. 6-Azaspiro[2.5]octane hydrochloride can be used for the synthesis of various compounds including pharmaceuticals, agrochemicals, flavors and fragrances, dyes and pigments, polymers and plasticizers, perfumes and flavorings, agricultural chemicals, surfactants, catalysts and solvents.

Formula: C₇H₁₄ClN

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 147.65 g/mol

Ref: 3D-FA141499

6-Azaspiro[2.5]octane hydrochloride

CAS: 1037834-62-0

Formula: C₇H₁₄ClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.65

Ref: 10-F226617