CymitQuimica logo

CAS 103784-04-9

:

2H-Benzimidazol-2-one, 1-(3-bromopropyl)-1,3-dihydro-

Description:
2H-Benzimidazol-2-one, 1-(3-bromopropyl)-1,3-dihydro- is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a bromopropyl substituent, which introduces a bromine atom and a propyl chain, influencing its reactivity and solubility. The presence of the bromine atom can enhance the compound's ability to participate in nucleophilic substitution reactions, making it useful in various synthetic applications. The dihydro form indicates that the compound may exist in a partially saturated state, which can affect its stability and interaction with biological systems. Typically, compounds like this may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. Its specific properties, such as melting point, solubility, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a class of heterocyclic compounds with diverse applications in medicinal chemistry and material science.
Formula:C10H11BrN2O
InChI:InChI=1S/C10H11BrN2O/c11-6-3-7-13-9-5-2-1-4-8(9)12-10(13)14/h1-2,4-5H,3,6-7H2,(H,12,14)
InChI key:MTCFXOOPGLLIDK-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)NC(=O)N2CCCBr
Found 4 products.