CymitQuimica logo

CAS 1037840-79-1

:

1H-Indazole-4-carboxylic acid, 5-broMo-, Methyl ester

Description:
1H-Indazole-4-carboxylic acid, 5-bromo-, methyl ester is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a carboxylic acid group at the 4-position and a bromine atom at the 5-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The methyl ester functional group indicates that the carboxylic acid is esterified with methanol, which can influence the compound's solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various substitution reactions, which can be exploited to develop derivatives with enhanced properties. Additionally, the bromine atom can serve as a useful handle for further functionalization. Overall, this compound's unique structural features and functional groups make it a valuable candidate for further investigation in chemical and biological studies.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)8-5-4-11-12-7(5)3-2-6(8)10/h2-4H,1H3,(H,11,12)
InChI key:ZVKNYIAOEMIAKP-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=CC2=C1C=NN2)Br
Synonyms:
  • Methyl 5-bromo-1H-indazole-4-carboxylate
Found 6 products.