CymitQuimica logo

CAS 1037841-25-0

:

1H-Indazole-4-carboxylic acid, 5-broMo-6-fluoro-, Methyl ester

Description:
1H-Indazole-4-carboxylic acid, 5-bromo-6-fluoro-, methyl ester is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a carboxylic acid functional group at the 4-position and a methyl ester group indicates that it can undergo hydrolysis to yield the corresponding acid. The bromine and fluorine substituents at the 5 and 6 positions, respectively, contribute to its reactivity and potential biological activity, making it of interest in medicinal chemistry. This compound may exhibit properties such as moderate solubility in organic solvents and varying stability under different pH conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of halogen atoms can influence the compound's lipophilicity and interaction with biological targets, making it a candidate for further investigation in drug discovery and development.
Formula:C9H6BrFN2O2
InChI:InChI=1S/C9H6BrFN2O2/c1-15-9(14)7-4-3-12-13-6(4)2-5(11)8(7)10/h2-3H,1H3,(H,12,13)
InChI key:DPUNGDFMRGBMOY-UHFFFAOYSA-N
SMILES:COC(=O)C1=C2C=NNC2=CC(=C1Br)F
Found 4 products.