CAS 103788-61-0
:4-(Chloromethyl)-5-methyl-2-phenyl-1,3-oxazole
Description:
4-(Chloromethyl)-5-methyl-2-phenyl-1,3-oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of a methyl group and a phenyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with other substances. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The chloromethyl group can serve as a reactive site for nucleophilic substitution reactions, allowing for the synthesis of various derivatives. Additionally, the compound's structure suggests potential applications in materials science or as intermediates in organic synthesis. Safety data should be consulted, as halogenated compounds can pose health risks, and proper handling and disposal procedures are essential in laboratory settings.
Formula:C11H10ClNO
InChI:InChI=1/C11H10ClNO/c1-8-10(7-12)13-11(14-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3
InChI key:InChIKey=VCTKYTBWZTZPHF-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(OC1C)C2=CC=CC=C2
Synonyms:- 4-Chloromethyl-2-phenyl-5-methyloxazole
- 4-Chloromethyl-5-Methyl-2-Phenyloxazole
- 5-Methyl-2-phenyl-4-(chloromethyl)oxazole
- Chloromethyl-5-methyl-2-phenyloxazole
- Oxazole, 4-(chloromethyl)-5-methyl-2-phenyl-
- [5-Methyl-2-phenyloxazol-4-yl]methyl chloride
- 4-(Chloromethyl)-5-methyl-2-phenyl-1,3-oxazole
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-(Chloromethyl)-5-methyl-2-phenyloxazole
CAS:Formula:C11H10ClNOPurity:98%Color and Shape:SolidMolecular weight:207.65624-Chloromethyl-5-methyl-2-phenyl-oxazole
CAS:4-Chloromethyl-5-methyl-2-phenyl-oxazoleFormula:C11H10ClNOPurity:95%Molecular weight:207.65624-(Chloromethyl)-5-methyl-2-phenyloxazole
CAS:Formula:C11H10ClNOPurity:98%Color and Shape:SolidMolecular weight:207.664-Chloromethyl-5-methyl-2-phenyl-oxazole
CAS:Controlled ProductApplications 4-CHLOROMETHYL-5-METHYL-2-PHENYL-OXAZOLE (cas# 103788-61-0) is a useful research chemical.
Formula:C11H10NOClColor and Shape:NeatMolecular weight:207.654-(Chloromethyl)-5-methyl-2-phenyl-1,3-oxazole
CAS:4-Chloromethyl-5-methyl-2-phenyloxazole is an oxychloride that has been shown to have hypoglycemic activity. This compound is a derivative of 2,5-dimethyloxazole and has been synthesized in high yield by the reaction of phosphorus oxychloride with butanedione. The structure activity relationship studies have shown that the presence of chlorine in the 5 position on this molecule increases its hypoglycemic activity. This compound also reacts with acetate solution to give elemental analysis, which can be used to identify it. br>br>Formula:C11H10ClNOPurity:Min. 95%Molecular weight:207.66 g/mol





