CymitQuimica logo

CAS 103791-35-1

:

1H-Inden-1-ol, 1-(aminomethyl)-2,3-dihydro-

Description:
1H-Inden-1-ol, 1-(aminomethyl)-2,3-dihydro- is an organic compound characterized by its bicyclic structure, which includes an indene moiety with a hydroxyl group and an aminomethyl substituent. This compound features a fused ring system that contributes to its unique chemical properties. The presence of the hydroxyl (-OH) group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. The aminomethyl group introduces basicity and potential for further chemical reactions, such as nucleophilic substitutions or coupling reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific interactions and stability can be influenced by factors such as pH and the presence of other functional groups. Overall, 1H-Inden-1-ol, 1-(aminomethyl)-2,3-dihydro- is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c11-7-10(12)6-5-8-3-1-2-4-9(8)10/h1-4,12H,5-7,11H2
InChI key:STXJWRAZXHJWQO-UHFFFAOYSA-N
SMILES:C1CC(C2=CC=CC=C21)(CN)O
Found 2 products.