CAS 103796-52-7
:4-ETHOXY-3-METHOXYPHENYLACETONITRILE
Description:
4-Ethoxy-3-methoxyphenylacetonitrile, with the CAS number 103796-52-7, is an organic compound characterized by its aromatic structure, which includes both ethoxy and methoxy functional groups attached to a phenyl ring. This compound features a nitrile group (-C≡N) that contributes to its reactivity and potential applications in organic synthesis. The presence of the ethoxy and methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, making it of interest in various chemical reactions and applications. Typically, compounds like this may exhibit moderate to high polarity due to the electronegative atoms in the functional groups. Additionally, the nitrile functionality can participate in nucleophilic addition reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken due to potential toxicity or reactivity.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c1-3-14-10-5-4-9(6-7-12)8-11(10)13-2/h4-5,8H,3,6H2,1-2H3
SMILES:CCOc1ccc(CC#N)cc1OC
Synonyms:- Benzeneacetonitrile, 4-Ethoxy-3-Methoxy-
- Verapamil Impurity 30
- 4-ETHOXY-3-METHOXYPHENYLACETONITRILE
- 2-(4-Ethoxy-3-methoxyphenyl)acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Ethoxy-3-methoxyphenylacetonitrile
CAS:4-Ethoxy-3-methoxyphenylacetonitrile
Molecular weight:191.22642g/mol


