CymitQuimica logo

CAS 103796-62-9

:

1H-Indol-6-amine, 2,3-dihydro-1-methyl-

Description:
1H-Indol-6-amine, 2,3-dihydro-1-methyl- (CAS 103796-62-9) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features an amine group at the 6-position and a methyl group at the 1-position of the indole framework. The presence of the dihydro group indicates that the compound has a saturated bond in the pyrrole ring, which can influence its reactivity and stability. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. They may interact with various biological targets, potentially leading to applications in drug development. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and functional groups. Overall, 1H-Indol-6-amine, 2,3-dihydro-1-methyl- represents a class of compounds that can be explored for their therapeutic potential and chemical reactivity.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-11-5-4-7-2-3-8(10)6-9(7)11/h2-3,6H,4-5,10H2,1H3
InChI key:ZWXDYSNVJMNJQS-UHFFFAOYSA-N
SMILES:CN1CCC2=C1C=C(C=C2)N
Found 1 products.