CAS 1038-95-5
:Tri-p-tolylphosphine
Description:
Tri-p-tolylphosphine, with the CAS number 1038-95-5, is an organophosphorus compound characterized by the presence of three p-tolyl (para-methylphenyl) groups attached to a central phosphorus atom. This compound typically appears as a white to light yellow solid and is known for its stability and relatively low volatility. Tri-p-tolylphosphine is a versatile ligand in coordination chemistry, often used in catalysis and organometallic chemistry due to its ability to stabilize metal complexes. It exhibits good solubility in organic solvents, making it suitable for various synthetic applications. The presence of the electron-donating methyl groups enhances its nucleophilicity, allowing it to participate in various chemical reactions, including those involving transition metals. Additionally, tri-p-tolylphosphine can be utilized in the synthesis of other phosphine derivatives and is valuable in the development of phosphine-catalyzed reactions. Safety data should be consulted, as with all chemical substances, to ensure proper handling and usage in laboratory settings.
Formula:C21H21P
InChI:InChI=1S/C21H21P/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3
InChI key:InChIKey=WXAZIUYTQHYBFW-UHFFFAOYSA-N
SMILES:P(C1=CC=C(C)C=C1)(C2=CC=C(C)C=C2)C3=CC=C(C)C=C3
Synonyms:- Nsc 97371
- Phosphine, tri-p-tolyl-
- TPTP (phosphine)
- Tptp
- Tri(4-methylphenyl)phosphine
- Tri-p-tolylphosphine
- Tris(4-Metilfenil)Fosfina
- Tris(4-methylphenyl)phosphin
- Tris(4-methylphenyl)phosphine
- Tris(p-methylphenyl)phosphine
- Tris(p-tolyl)phosphine
- Tri-p-tolyl-phosphane
- Phosphine, tris(4-methylphenyl)-
- phosphine, tris(4-methylphenyl)-
- TRIS-(4-TOLYL)PHOSPHINE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Tri(p-tolyl)phosphine
CAS:Formula:C21H21PPurity:>96.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:304.37Tri-p-tolylphosphine, 98%
CAS:Tri-p-tolylphosphine, 98%
Formula:(pCH3C6H4)3PPurity:98%Color and Shape:white xtl.Molecular weight:304.37tris(4-methylphenyl)phosphine
CAS:tris(4-methylphenyl)phosphineFormula:C21H21PPurity:98%Color and Shape:SolidMolecular weight:304.3652Tri-p-tolyl phosphine
CAS:Tri-p-tolyl phosphine is a coordination compound with the formula (CH3)3P. This molecule has a tetranuclear geometry, with four phosphorus atoms arranged in two square pyramids and two linear rows. The P-N bonds are strong, which leads to steric interactions that restrict rotation of the molecule. Tri-p-tolyl phosphine binds to DNA and inhibits cancer cell growth by causing DNA strand breakages. It binds to the nitrogen atoms of guanine, forming intramolecular hydrogen bonds, and also interacts with the phosphate groups of DNA. These interactions lead to inhibition of RNA synthesis and DNA replication.
Formula:C21H21PPurity:Min. 95%Color and Shape:White PowderMolecular weight:304.37 g/molTri-p-tolylphosphine
CAS:Formula:C21H21PPurity:96%Color and Shape:Solid, White to almost white powderMolecular weight:304.373






