CymitQuimica logo

CAS 103802-41-1

:

6-ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid

Description:
6-Ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid is a chemical compound that belongs to the class of quinoline derivatives, which are known for their diverse biological activities. This compound features a quinoline core structure, characterized by a bicyclic system containing a nitrogen atom. The presence of the ethyl group and the carboxylic acid functional group contributes to its unique chemical properties, including potential solubility in organic solvents and reactivity in various chemical reactions. The keto group at the 4-position enhances its electrophilic character, making it a candidate for further derivatization. This compound may exhibit biological activities, such as antimicrobial or anti-inflammatory properties, which are common in quinoline derivatives. Its structural features suggest potential applications in medicinal chemistry and drug development. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation through experimental studies and literature review.
Formula:C12H11NO3
InChI:InChI=1/C12H11NO3/c1-2-7-3-4-10-8(5-7)11(14)9(6-13-10)12(15)16/h3-6H,2H2,1H3,(H,13,14)(H,15,16)
InChI key:RESVKOSPFKHQBK-UHFFFAOYSA-N
SMILES:CCc1ccc2c(c1)c(=O)c(c[nH]2)C(=O)O
Synonyms:
  • 3-Quinolinecarboxylic acid, 6-ethyl-4-hydroxy-
  • 6-Ethyl-4-hydroxyquinoline-3-carboxylic acid
Found 3 products.