CAS 10381-75-6: 8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione
Description:8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione, with the CAS number 10381-75-6, is a purine derivative characterized by its unique structural features, including a bromine atom at the 8-position and two methyl groups at the 1 and 3 positions of the purine ring. This compound exhibits properties typical of purines, such as being a potential nucleobase analog, which may influence its biological activity. It is generally soluble in polar organic solvents and may exhibit moderate stability under standard conditions. The presence of the bromine substituent can enhance its reactivity and may influence its interaction with biological macromolecules, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and UV-Vis spectroscopy, aiding in its identification and characterization. Overall, 8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione is a compound of interest for research in various fields, including biochemistry and drug development.
Formula:C7H7BrN4O2
InChI:InChI=1S/C7H7BrN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10)
InChI key:InChIKey=SKTFQHRVFFOHTQ-UHFFFAOYSA-N
SMILES:O=C1C=2NC(Br)=NC2N(C(=O)N1C)C
- Synonyms:
- 1H-Purine-2,6-dione, 8-bromo-3,7-dihydro-1,3-dimethyl-
- 1H-Purine-2,6-dione, 8-bromo-3,9-dihydro-1,3-dimethyl-
- 8-Bromo Theophylline
- 8-Bromo-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione
- 8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione
- 8-bromo-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
- Bromotheaminum
- Bromotheophylline
- Nsc 164940
- Theophylline, 8-bromo-
- See more synonyms
- 8-Bromotheophylline