CAS 10381-75-6
:8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione
Description:
8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione, with the CAS number 10381-75-6, is a purine derivative characterized by its unique structural features, including a bromine atom at the 8-position and two methyl groups at the 1 and 3 positions of the purine ring. This compound exhibits properties typical of purines, such as being a potential nucleobase analog, which may influence its biological activity. It is generally soluble in polar organic solvents and may exhibit moderate stability under standard conditions. The presence of the bromine substituent can enhance its reactivity and may influence its interaction with biological macromolecules, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and UV-Vis spectroscopy, aiding in its identification and characterization. Overall, 8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione is a compound of interest for research in various fields, including biochemistry and drug development.
Formula:C7H7BrN4O2
InChI:InChI=1S/C7H7BrN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10)
InChI key:InChIKey=SKTFQHRVFFOHTQ-UHFFFAOYSA-N
SMILES:O=C1C2=C(N(C)C(=O)N1C)N=C(Br)N2
Synonyms:- 1H-Purine-2,6-dione, 8-bromo-3,7-dihydro-1,3-dimethyl-
- 1H-Purine-2,6-dione, 8-bromo-3,9-dihydro-1,3-dimethyl-
- 8-Bromo Theophylline
- 8-Bromo-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione
- 8-Bromo-3,9-dihydro-1,3-dimethyl-1H-purine-2,6-dione
- 8-bromo-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione
- Bromotheaminum
- Bromotheophylline
- Nsc 164940
- Theophylline, 8-bromo-
- 8-Bromotheophylline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
8-Bromotheophylline
CAS:Theophylline and aminophylline (excluding fenetylline) and their derivatives, salts thereof, not elsewhere specified or includedFormula:C7H7BrN4O2Color and Shape:White PowderMolecular weight:257.975248-bromo-1,3-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
CAS:Formula:C7H7BrN4O2Purity:96%Color and Shape:SolidMolecular weight:259.06018-Bromotheophylline
CAS:Formula:C7H7BrN4O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:259.068-Bromotheophylline
CAS:8-Bromotheophylline, part of pamabrom, is a weak diuretic for premenstrual syndrome relief.Formula:C7H7BrN4O2Purity:98.49%Color and Shape:White Crystalline PowderMolecular weight:259.068-Bromotheophylline
CAS:Controlled ProductApplications The active component in the diuretic Diurex.
Formula:C7H7BrN4O2Color and Shape:NeatMolecular weight:259.068-Bromotheophylline
CAS:Formula:C7H7BrN4O2Purity:97%Color and Shape:Liquid, No data available.Molecular weight:259.0638-Bromotheophylline
CAS:Controlled Product8-Bromotheophylline is a drug that binds to adenosine receptors and prevents the reuptake of adenosine, which leads to an increase in the concentration of adenosine at the receptor. It has been shown to inhibit the enzyme phosphodiesterase and potassium ion channels, leading to increased concentrations of serotonin in the brain. 8-Bromotheophylline is used for treating psychotic disorders such as schizophrenia and depression. 8-Bromotheophylline also has been shown to be effective against infectious diseases, including tuberculosis and infections caused by bacteria that are resistant to penicillin and erythromycin.
Formula:C7H7BrN4O2Purity:Min. 95%Molecular weight:259.06 g/mol











