CymitQuimica logo

CAS 1038392-13-0

:

(1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl)Methanol

Description:
(1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl)Methanol is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a tetrahydro-pyran moiety. The presence of the pyrazole ring suggests potential biological activity, as pyrazoles are often found in pharmaceuticals and agrochemicals. The tetrahydro-pyran group contributes to the compound's cyclic structure, enhancing its stability and solubility in organic solvents. The methanol functional group indicates the presence of a hydroxyl (-OH) group, which can participate in hydrogen bonding, influencing the compound's reactivity and interaction with other molecules. This compound may exhibit properties such as moderate polarity, making it suitable for various applications in organic synthesis and medicinal chemistry. Additionally, its molecular structure may allow for diverse functionalization, potentially leading to the development of derivatives with tailored properties. Overall, the characteristics of this compound suggest it could be of interest in research and development within the fields of chemistry and pharmacology.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c12-7-8-5-10-11(6-8)9-3-1-2-4-13-9/h5-6,9,12H,1-4,7H2
InChI key:PBHINQDJZGHENZ-UHFFFAOYSA-N
SMILES:C1CCOC(C1)N2C=C(C=N2)CO
Synonyms:
  • (1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-4-yl)Methanol
  • 1H-Pyrazole-4-methanol, 1-(tetrahydro-2H-pyran-2-yl)-
Found 4 products.